C19H30N3O16P3 — CID 165052020
[[(2R,5R)-5-[2,4-dioxo-5-[(E)-3-(propanoylamino)prop-1-enyl]pyrimidin-1-yl]-3-(prop-2-enoxymethoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 165052020) has the molecular formula C19H30N3O16P3 and a molecular weight of 649.38 g/mol. Its IUPAC name is [[(2R,5R)-5-[2,4-dioxo-5-[(E)-3-(propanoylamino)prop-1-enyl]pyrimidin-1-yl]-3-(prop-2-enoxymethoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-[2,4-dioxo-5-[(E)-3-(propanoylamino)prop-1-enyl]pyrimidin-1-yl]-3-(prop-2-enoxymethoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 165052020 |
| Molecular Formula | C19H30N3O16P3 |
| Molecular Weight | 649.38 g/mol |
| Exact Mass | 649.08 |
| IUPAC Name | [[(2R,5R)-5-[2,4-dioxo-5-[(E)-3-(propanoylamino)prop-1-enyl]pyrimidin-1-yl]-3-(prop-2-enoxymethoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=CCOCOC1C[C@H](n2cc(/C=C/CNC(=O)CC)c(=O)[nH]c2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C19H30N3O16P3/c1-3-8-33-12-34-14-9-17(22-10-13(18(24)21-19(22)25)6-5-7-20-16(23)4-2)36-15(14)11-35-40(29,30)38-41(31,32)37-39(26,27)28/h3,5-6,10,14-15,17H,1,4,7-9,11-12H2,2H3,(H,20,23)(H,29,30)(H,31,32)(H,21,24,25)(H2,26,27,28)/b6-5+/t14?,15-,17-/m1/s1 |
| InChIKey | PUSRTKTWQKQUGK-NCJBNBBZSA-N |
| XLogP | 0.25 |
| TPSA | 271.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|