C31H48BN5O22P4 — CID 87413702
CID 87413702 (PubChem CID 87413702) has the molecular formula C31H48BN5O22P4 and a molecular weight of 977.45 g/mol.
| Compound Name | CID 87413702 |
|---|---|
| PubChem CID | 87413702 |
| Molecular Formula | C31H48BN5O22P4 |
| Molecular Weight | 977.45 g/mol |
| Exact Mass | 977.18 |
| IUPAC Name | — |
| SMILES | [B]c1cn(C2CC(O)C(COP(=O)(O)OCCCCCCCCCC(=O)NC/C=C/c3cn(C4CCC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O4)c(=O)[nH]c3=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C31H48BN5O22P4/c32-22-17-37(31(43)35-29(22)41)27-15-23(38)24(57-27)19-55-61(47,48)53-14-7-5-3-1-2-4-6-10-25(39)33-13-8-9-20-16-36(30(42)34-28(20)40)26-12-11-21(56-26)18-54-62(49,50)59-63(51,52)58-60(44,45)46/h8-9,16-17,21,23-24,26-27,38H,1-7,10-15,18-19H2,(H,33,39)(H,47,48)(H,49,50)(H,51,52)(H,34,40,42)(H,35,41,43)(H2,44,45,46)/b9-8+ |
| InChIKey | RNEITWNWWQIUKY-CMDGGOBGSA-N |
| XLogP | -0.07 |
| TPSA | 393.09 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.45 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|