C21H23F3N5O15P3 — CID 175676180
[[(2R,3S,5R)-5-[2,4-dioxo-5-[(E)-3-[[4-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]prop-1-enyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 175676180) has the molecular formula C21H23F3N5O15P3 and a molecular weight of 735.35 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[2,4-dioxo-5-[(E)-3-[[4-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]prop-1-enyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[2,4-dioxo-5-[(E)-3-[[4-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]prop-1-enyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 175676180 |
| Molecular Formula | C21H23F3N5O15P3 |
| Molecular Weight | 735.35 g/mol |
| Exact Mass | 735.04 |
| IUPAC Name | [[(2R,3S,5R)-5-[2,4-dioxo-5-[(E)-3-[[4-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]prop-1-enyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=C(NC/C=C/c1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O)c1ccc(C2(C(F)(F)F)N=N2)cc1 |
| InChI | InChI=1S/C21H23F3N5O15P3/c22-21(23,24)20(27-28-20)13-5-3-11(4-6-13)17(31)25-7-1-2-12-9-29(19(33)26-18(12)32)16-8-14(30)15(42-16)10-41-46(37,38)44-47(39,40)43-45(34,35)36/h1-6,9,14-16,30H,7-8,10H2,(H,25,31)(H,37,38)(H,39,40)(H,26,32,33)(H2,34,35,36)/b2-1+/t14-,15+,16+/m0/s1 |
| InChIKey | KOEQBJPAMFUBBN-HRTYSXDVSA-N |
| XLogP | 1.15 |
| TPSA | 297.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|