C13H16F3N3O6 — CID 126544648
N-[[1-[(3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 126544648) has the molecular formula C13H16F3N3O6 and a molecular weight of 367.28 g/mol. Its IUPAC name is N-[[1-[(3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[1-[(3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 126544648 |
| Molecular Formula | C13H16F3N3O6 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[[1-[(3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | CC[C@H]1OC(n2cc(CNC(=O)C(F)(F)F)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16F3N3O6/c1-2-6-7(20)8(21)10(25-6)19-4-5(9(22)18-12(19)24)3-17-11(23)13(14,15)16/h4,6-8,10,20-21H,2-3H2,1H3,(H,17,23)(H,18,22,24)/t6-,7-,8-,10?/m1/s1 |
| InChIKey | PQHYGXTXBUXQFX-JSDYZDKHSA-N |
| XLogP | -1.26 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |