C12H13F5N2O6 — CID 23263688
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2,2,3,3,3-pentafluoropropyl)pyrimidine-2,4-dione (PubChem CID 23263688) has the molecular formula C12H13F5N2O6 and a molecular weight of 376.23 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2,2,3,3,3-pentafluoropropyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2,2,3,3,3-pentafluoropropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23263688 |
| Molecular Formula | C12H13F5N2O6 |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2,2,3,3,3-pentafluoropropyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F5N2O6/c13-11(14,12(15,16)17)1-4-2-19(10(24)18-8(4)23)9-7(22)6(21)5(3-20)25-9/h2,5-7,9,20-22H,1,3H2,(H,18,23,24)/t5-,6-,7-,9-/m1/s1 |
| InChIKey | UPFWNEVZNPEDKT-JXOAFFINSA-N |
| XLogP | -1.11 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|