C12H11F7N2O6 — CID 22214244
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidine-2,4-dione (PubChem CID 22214244) has the molecular formula C12H11F7N2O6 and a molecular weight of 412.21 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22214244 |
| Molecular Formula | C12H11F7N2O6 |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F7N2O6/c13-10(14,11(15,16)12(17,18)19)3-1-21(9(26)20-7(3)25)8-6(24)5(23)4(2-22)27-8/h1,4-6,8,22-24H,2H2,(H,20,25,26)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | FAODJOVFCLFVEG-UAKXSSHOSA-N |
| XLogP | -0.56 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|