C13H16F3N7O5 — CID 173484328
N-[[4-amino-1-[4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 173484328) has the molecular formula C13H16F3N7O5 and a molecular weight of 407.31 g/mol. Its IUPAC name is N-[[4-amino-1-[4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[4-amino-1-[4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 173484328 |
| Molecular Formula | C13H16F3N7O5 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[[4-amino-1-[4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | [N-]=[N+]=NCOC1CC(n2cc(CNC(=O)C(F)(F)F)c(N)nc2=O)OC1CO |
| InChI | InChI=1S/C13H16F3N7O5/c14-13(15,16)11(25)19-2-6-3-23(12(26)21-10(6)17)9-1-7(8(4-24)28-9)27-5-20-22-18/h3,7-9,24H,1-2,4-5H2,(H,19,25)(H2,17,21,26) |
| InChIKey | LEIXGRQMDYIGLA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 177.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|