C17H21F3N4O5 — CID 56997855
N-[6-[4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]hex-5-ynyl]-2,2,2-trifluoroacetamide (PubChem CID 56997855) has the molecular formula C17H21F3N4O5 and a molecular weight of 418.37 g/mol. Its IUPAC name is N-[6-[4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]hex-5-ynyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-[4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]hex-5-ynyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 56997855 |
| Molecular Formula | C17H21F3N4O5 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[6-[4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]hex-5-ynyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1nc(=O)n([C@H]2CC(O)[C@@H](CO)O2)cc1C#CCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N4O5/c18-17(19,20)15(27)22-6-4-2-1-3-5-10-8-24(16(28)23-14(10)21)13-7-11(26)12(9-25)29-13/h8,11-13,25-26H,1-2,4,6-7,9H2,(H,22,27)(H2,21,23,28)/t11?,12-,13-/m1/s1 |
| InChIKey | IQBIUHMLQFLPTJ-VFRRUGBOSA-N |
| XLogP | -0.33 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|