C16H19F3N8O5 — CID 173484331
2-amino-7-[4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-[[(3,3,3-trifluoro-2-oxopropyl)amino]methyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 173484331) has the molecular formula C16H19F3N8O5 and a molecular weight of 460.37 g/mol. Its IUPAC name is 2-amino-7-[4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-[[(3,3,3-trifluoro-2-oxopropyl)amino]methyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-[4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-[[(3,3,3-trifluoro-2-oxopropyl)amino]methyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 173484331 |
| Molecular Formula | C16H19F3N8O5 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-amino-7-[4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-[[(3,3,3-trifluoro-2-oxopropyl)amino]methyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | [N-]=[N+]=NCOC1CC(n2cc(CNCC(=O)C(F)(F)F)c3c(=O)[nH]c(N)nc32)OC1CO |
| InChI | InChI=1S/C16H19F3N8O5/c17-16(18,19)10(29)3-22-2-7-4-27(13-12(7)14(30)25-15(20)24-13)11-1-8(9(5-28)32-11)31-6-23-26-21/h4,8-9,11,22,28H,1-3,5-6H2,(H3,20,24,25,30) |
| InChIKey | MXKKUUWYKXXWNF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 193.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|