C16H17F3N6O5 — CID 122677252
N-[3-[1-[(2R,4R,5R)-4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-4-methylidene-2-oxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide (PubChem CID 122677252) has the molecular formula C16H17F3N6O5 and a molecular weight of 430.34 g/mol. Its IUPAC name is N-[3-[1-[(2R,4R,5R)-4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-4-methylidene-2-oxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[1-[(2R,4R,5R)-4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-4-methylidene-2-oxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 122677252 |
| Molecular Formula | C16H17F3N6O5 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[3-[1-[(2R,4R,5R)-4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-4-methylidene-2-oxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
| SMILES | C=C1NC(=O)N([C@H]2C[C@@H](OCN=[N+]=[N-])[C@@H](CO)O2)C=C1C#CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N6O5/c1-9-10(3-2-4-21-14(27)16(17,18)19)6-25(15(28)23-9)13-5-11(12(7-26)30-13)29-8-22-24-20/h6,11-13,26H,1,4-5,7-8H2,(H,21,27)(H,23,28)/t11-,12-,13-/m1/s1 |
| InChIKey | SNQKPJSIJMYGRW-JHJVBQTASA-N |
| XLogP | 0.85 |
| TPSA | 148.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|