C12H16N2O5 — CID 142275460
[2-(hydroxymethyl)-5-(5-methyl-4-methylidene-2-oxopyrimidin-1-yl)oxolan-3-yl] formate (PubChem CID 142275460) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is [2-(hydroxymethyl)-5-(5-methyl-4-methylidene-2-oxopyrimidin-1-yl)oxolan-3-yl] formate.
| Compound Name | [2-(hydroxymethyl)-5-(5-methyl-4-methylidene-2-oxopyrimidin-1-yl)oxolan-3-yl] formate |
|---|---|
| PubChem CID | 142275460 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [2-(hydroxymethyl)-5-(5-methyl-4-methylidene-2-oxopyrimidin-1-yl)oxolan-3-yl] formate |
| SMILES | C=C1NC(=O)N(C2CC(OC=O)C(CO)O2)C=C1C |
| InChI | InChI=1S/C12H16N2O5/c1-7-4-14(12(17)13-8(7)2)11-3-9(18-6-16)10(5-15)19-11/h4,6,9-11,15H,2-3,5H2,1H3,(H,13,17) |
| InChIKey | XCEMWRFAHWBOHZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|