C14H21N5O3 — CID 159508479
1-[(2R,5S)-4-azido-5-(propoxymethyl)oxolan-2-yl]-5-methyl-4-methylidenepyrimidin-2-one (PubChem CID 159508479) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-[(2R,5S)-4-azido-5-(propoxymethyl)oxolan-2-yl]-5-methyl-4-methylidenepyrimidin-2-one.
| Compound Name | 1-[(2R,5S)-4-azido-5-(propoxymethyl)oxolan-2-yl]-5-methyl-4-methylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 159508479 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-[(2R,5S)-4-azido-5-(propoxymethyl)oxolan-2-yl]-5-methyl-4-methylidenepyrimidin-2-one |
| SMILES | C=C1NC(=O)N([C@H]2CC(N=[N+]=[N-])[C@@H](COCCC)O2)C=C1C |
| InChI | InChI=1S/C14H21N5O3/c1-4-5-21-8-12-11(17-18-15)6-13(22-12)19-7-9(2)10(3)16-14(19)20/h7,11-13H,3-6,8H2,1-2H3,(H,16,20)/t11?,12-,13-/m1/s1 |
| InChIKey | MAQNJLIKDDWBKH-VFRRUGBOSA-N |
| XLogP | 2.65 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|