C10H19N7O8P2 — CID 59008702
[[[(2S,3R,5R)-5-(6-amino-5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl]amino]phosphonic acid (PubChem CID 59008702) has the molecular formula C10H19N7O8P2 and a molecular weight of 427.25 g/mol. Its IUPAC name is [[[(2S,3R,5R)-5-(6-amino-5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl]amino]phosphonic acid.
| Compound Name | [[[(2S,3R,5R)-5-(6-amino-5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl]amino]phosphonic acid |
|---|---|
| PubChem CID | 59008702 |
| Molecular Formula | C10H19N7O8P2 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | [[[(2S,3R,5R)-5-(6-amino-5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl]amino]phosphonic acid |
| SMILES | CC1=CN([C@H]2C[C@@H](N=[N+]=[N-])[C@@H](COP(=O)(O)NP(=O)(O)O)O2)C(=O)NC1N |
| InChI | InChI=1S/C10H19N7O8P2/c1-5-3-17(10(18)13-9(5)11)8-2-6(14-15-12)7(25-8)4-24-27(22,23)16-26(19,20)21/h3,6-9H,2,4,11H2,1H3,(H,13,18)(H4,16,19,20,21,22,23)/t6-,7-,8-,9?/m1/s1 |
| InChIKey | MRKFUPDNONMYHB-BYBOBHAWSA-N |
| XLogP | -0.21 |
| TPSA | 232.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|