C15H20Cl3N6O8P — CID 3011018
methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(2,2,2-trichloroethoxy)phosphoryl]amino]acetate (PubChem CID 3011018) has the molecular formula C15H20Cl3N6O8P and a molecular weight of 549.69 g/mol. Its IUPAC name is methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(2,2,2-trichloroethoxy)phosphoryl]amino]acetate.
| Compound Name | methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(2,2,2-trichloroethoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 3011018 |
| Molecular Formula | C15H20Cl3N6O8P |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(2,2,2-trichloroethoxy)phosphoryl]amino]acetate |
| SMILES | COC(=O)CNP(=O)(OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-])OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H20Cl3N6O8P/c1-8-5-24(14(27)21-13(8)26)11-3-9(22-23-19)10(32-11)6-30-33(28,20-4-12(25)29-2)31-7-15(16,17)18/h5,9-11H,3-4,6-7H2,1-2H3,(H,20,28)(H,21,26,27)/t9-,10+,11+,33?/m0/s1 |
| InChIKey | HRBVZRDHWDFMSF-SIACWOMSSA-N |
| XLogP | 2.09 |
| TPSA | 186.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|