C20H31N6O9PS — CID 10951875
methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]acetate (PubChem CID 10951875) has the molecular formula C20H31N6O9PS and a molecular weight of 562.54 g/mol. Its IUPAC name is methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]acetate.
| Compound Name | methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 10951875 |
| Molecular Formula | C20H31N6O9PS |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | methyl 2-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]acetate |
| SMILES | COC(=O)CNP(=O)(OCCSC(=O)C(C)(C)C)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C20H31N6O9PS/c1-12-10-26(19(30)23-17(12)28)15-8-13(24-25-21)14(35-15)11-34-36(31,22-9-16(27)32-5)33-6-7-37-18(29)20(2,3)4/h10,13-15H,6-9,11H2,1-5H3,(H,22,31)(H,23,28,30)/t13-,14+,15+,36?/m0/s1 |
| InChIKey | ANGLIEUTCYTADO-SSHVKWDBSA-N |
| XLogP | 2.02 |
| TPSA | 203.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|