C14H23N5O3 — CID 139442961
3-[(2R,5S)-4-azido-5-(butoxymethyl)oxolan-2-yl]-5-methyl-1,6-dihydropyrimidin-2-one (PubChem CID 139442961) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[(2R,5S)-4-azido-5-(butoxymethyl)oxolan-2-yl]-5-methyl-1,6-dihydropyrimidin-2-one.
| Compound Name | 3-[(2R,5S)-4-azido-5-(butoxymethyl)oxolan-2-yl]-5-methyl-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 139442961 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 3-[(2R,5S)-4-azido-5-(butoxymethyl)oxolan-2-yl]-5-methyl-1,6-dihydropyrimidin-2-one |
| SMILES | CCCCOC[C@H]1O[C@@H](N2C=C(C)CNC2=O)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C14H23N5O3/c1-3-4-5-21-9-12-11(17-18-15)6-13(22-12)19-8-10(2)7-16-14(19)20/h8,11-13H,3-7,9H2,1-2H3,(H,16,20)/t11?,12-,13-/m1/s1 |
| InChIKey | ARQBVHJPLMMALI-VFRRUGBOSA-N |
| XLogP | 2.53 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|