C11H14FN5O2 — CID 90904264
1-[(2S,5R)-4-azido-5-ethyloxolan-2-yl]-5-fluoro-4-methylpyrimidin-2-one (PubChem CID 90904264) has the molecular formula C11H14FN5O2 and a molecular weight of 267.26 g/mol. Its IUPAC name is 1-[(2S,5R)-4-azido-5-ethyloxolan-2-yl]-5-fluoro-4-methylpyrimidin-2-one.
| Compound Name | 1-[(2S,5R)-4-azido-5-ethyloxolan-2-yl]-5-fluoro-4-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 90904264 |
| Molecular Formula | C11H14FN5O2 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-[(2S,5R)-4-azido-5-ethyloxolan-2-yl]-5-fluoro-4-methylpyrimidin-2-one |
| SMILES | CC[C@H]1O[C@H](n2cc(F)c(C)nc2=O)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C11H14FN5O2/c1-3-9-8(15-16-13)4-10(19-9)17-5-7(12)6(2)14-11(17)18/h5,8-10H,3-4H2,1-2H3/t8?,9-,10+/m1/s1 |
| InChIKey | PQYUKBSBHWOKGG-XVBQNVSMSA-N |
| XLogP | 2.07 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|