C13H17N7O3 — CID 174033395
4-amino-5-(3-aminoprop-1-ynyl)-1-[(2R,5S)-4-azido-5-(methoxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 174033395) has the molecular formula C13H17N7O3 and a molecular weight of 319.33 g/mol. Its IUPAC name is 4-amino-5-(3-aminoprop-1-ynyl)-1-[(2R,5S)-4-azido-5-(methoxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-(3-aminoprop-1-ynyl)-1-[(2R,5S)-4-azido-5-(methoxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 174033395 |
| Molecular Formula | C13H17N7O3 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-amino-5-(3-aminoprop-1-ynyl)-1-[(2R,5S)-4-azido-5-(methoxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | COC[C@H]1O[C@@H](n2cc(C#CCN)c(N)nc2=O)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C13H17N7O3/c1-22-7-10-9(18-19-16)5-11(23-10)20-6-8(3-2-4-14)12(15)17-13(20)21/h6,9-11H,4-5,7,14H2,1H3,(H2,15,17,21)/t9?,10-,11-/m1/s1 |
| InChIKey | OFJOAOVYXUBOFD-FHZGLPGMSA-N |
| XLogP | -0.25 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|