C19H23F3N4O6 — CID 121333192
[(2R,3S,5R)-5-[4-amino-5-(3-aminoprop-1-ynyl)-2-oxopyrimidin-1-yl]-2-[(2,2,2-trifluoroacetyl)oxymethyl]oxolan-3-yl] 2,2-dimethylpropanoate (PubChem CID 121333192) has the molecular formula C19H23F3N4O6 and a molecular weight of 460.41 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[4-amino-5-(3-aminoprop-1-ynyl)-2-oxopyrimidin-1-yl]-2-[(2,2,2-trifluoroacetyl)oxymethyl]oxolan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,5R)-5-[4-amino-5-(3-aminoprop-1-ynyl)-2-oxopyrimidin-1-yl]-2-[(2,2,2-trifluoroacetyl)oxymethyl]oxolan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 121333192 |
| Molecular Formula | C19H23F3N4O6 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | [(2R,3S,5R)-5-[4-amino-5-(3-aminoprop-1-ynyl)-2-oxopyrimidin-1-yl]-2-[(2,2,2-trifluoroacetyl)oxymethyl]oxolan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C[C@H](n2cc(C#CCN)c(N)nc2=O)O[C@@H]1COC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H23F3N4O6/c1-18(2,3)15(27)32-11-7-13(31-12(11)9-30-16(28)19(20,21)22)26-8-10(5-4-6-23)14(24)25-17(26)29/h8,11-13H,6-7,9,23H2,1-3H3,(H2,24,25,29)/t11-,12+,13+/m0/s1 |
| InChIKey | NODHJGGTFCJWDJ-YNEHKIRRSA-N |
| XLogP | 0.49 |
| TPSA | 148.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|