C19H30N3O6P — CID 170657909
[(2R,3S,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-[(2-methylpropan-2-yl)oxymethyl]oxolan-3-yl]oxy-tert-butylphosphinic acid (PubChem CID 170657909) has the molecular formula C19H30N3O6P and a molecular weight of 427.44 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-[(2-methylpropan-2-yl)oxymethyl]oxolan-3-yl]oxy-tert-butylphosphinic acid.
| Compound Name | [(2R,3S,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-[(2-methylpropan-2-yl)oxymethyl]oxolan-3-yl]oxy-tert-butylphosphinic acid |
|---|---|
| PubChem CID | 170657909 |
| Molecular Formula | C19H30N3O6P |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-[(2-methylpropan-2-yl)oxymethyl]oxolan-3-yl]oxy-tert-butylphosphinic acid |
| SMILES | C#Cc1cn([C@H]2C[C@H](OP(=O)(O)C(C)(C)C)[C@@H](COC(C)(C)C)O2)c(=O)nc1N |
| InChI | InChI=1S/C19H30N3O6P/c1-8-12-10-22(17(23)21-16(12)20)15-9-13(28-29(24,25)19(5,6)7)14(27-15)11-26-18(2,3)4/h1,10,13-15H,9,11H2,2-7H3,(H,24,25)(H2,20,21,23)/t13-,14+,15+/m0/s1 |
| InChIKey | MIYVJIJNWAIOBW-RRFJBIMHSA-N |
| XLogP | 2.28 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|