C11H16N3O14P3 — CID 46833783
[[(2S,3R,4S,5S)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 46833783) has the molecular formula C11H16N3O14P3 and a molecular weight of 507.18 g/mol. Its IUPAC name is [[(2S,3R,4S,5S)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3R,4S,5S)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 46833783 |
| Molecular Formula | C11H16N3O14P3 |
| Molecular Weight | 507.18 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | [[(2S,3R,4S,5S)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#Cc1cn([C@H]2O[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C11H16N3O14P3/c1-2-5-3-14(11(17)13-9(5)12)10-8(16)7(15)6(26-10)4-25-30(21,22)28-31(23,24)27-29(18,19)20/h1,3,6-8,10,15-16H,4H2,(H,21,22)(H,23,24)(H2,12,13,17)(H2,18,19,20)/t6-,7-,8-,10-/m0/s1 |
| InChIKey | XYIPCJFLQFSHQS-GHCJXIJMSA-N |
| XLogP | -2.23 |
| TPSA | 270.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.18 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|