C14H23N6O14P3 — CID 122543227
[[(2R,4S,5R)-5-[4-amino-5-[(1-ethyltriazol-4-yl)methyl]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122543227) has the molecular formula C14H23N6O14P3 and a molecular weight of 592.29 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-[4-amino-5-[(1-ethyltriazol-4-yl)methyl]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5R)-5-[4-amino-5-[(1-ethyltriazol-4-yl)methyl]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122543227 |
| Molecular Formula | C14H23N6O14P3 |
| Molecular Weight | 592.29 g/mol |
| Exact Mass | 592.05 |
| IUPAC Name | [[(2R,4S,5R)-5-[4-amino-5-[(1-ethyltriazol-4-yl)methyl]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCn1cc(Cc2cn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)[C@@H]3O)c(=O)nc2N)nn1 |
| InChI | InChI=1S/C14H23N6O14P3/c1-2-19-5-8(17-18-19)3-7-4-20(14(23)16-12(7)15)13-11(22)10(21)9(32-13)6-31-36(27,28)34-37(29,30)33-35(24,25)26/h4-5,9-11,13,21-22H,2-3,6H2,1H3,(H,27,28)(H,29,30)(H2,15,16,23)(H2,24,25,26)/t9-,10?,11+,13-/m1/s1 |
| InChIKey | RTVGYNLHDJFCMZ-JERFEKOUSA-N |
| XLogP | -2.01 |
| TPSA | 301.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.29 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|