C32H31N3O6 — CID 72736820
4-amino-1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-ethynylpyrimidin-2-one (PubChem CID 72736820) has the molecular formula C32H31N3O6 and a molecular weight of 553.62 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-ethynylpyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-ethynylpyrimidin-2-one |
|---|---|
| PubChem CID | 72736820 |
| Molecular Formula | C32H31N3O6 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-ethynylpyrimidin-2-one |
| SMILES | C#Cc1cn([C@H]2C[C@H](O)[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)c(=O)nc1N |
| InChI | InChI=1S/C32H31N3O6/c1-4-21-19-35(31(37)34-30(21)33)29-18-27(36)28(41-29)20-40-32(22-8-6-5-7-9-22,23-10-14-25(38-2)15-11-23)24-12-16-26(39-3)17-13-24/h1,5-17,19,27-29,36H,18,20H2,2-3H3,(H2,33,34,37)/t27-,28+,29+/m0/s1 |
| InChIKey | HBKIAVHUQNHTQF-ZGIBFIJWSA-N |
| XLogP | 3.48 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|