C17H26N3O6P — CID 166559447
[(2R,3S,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-(propan-2-yloxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid (PubChem CID 166559447) has the molecular formula C17H26N3O6P and a molecular weight of 399.38 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-(propan-2-yloxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid.
| Compound Name | [(2R,3S,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-(propan-2-yloxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 166559447 |
| Molecular Formula | C17H26N3O6P |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-(propan-2-yloxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid |
| SMILES | C#Cc1cn([C@H]2C[C@H](OP(=O)(O)C(C)C)[C@@H](COC(C)C)O2)c(=O)nc1N |
| InChI | InChI=1S/C17H26N3O6P/c1-6-12-8-20(17(21)19-16(12)18)15-7-13(26-27(22,23)11(4)5)14(25-15)9-24-10(2)3/h1,8,10-11,13-15H,7,9H2,2-5H3,(H,22,23)(H2,18,19,21)/t13-,14+,15+/m0/s1 |
| InChIKey | PBYJXNAYCJALRC-RRFJBIMHSA-N |
| XLogP | 1.50 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|