C10H13N5O3S — CID 10517080
1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-2-methylsulfanylpyrimidin-4-one (PubChem CID 10517080) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-2-methylsulfanylpyrimidin-4-one.
| Compound Name | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-2-methylsulfanylpyrimidin-4-one |
|---|---|
| PubChem CID | 10517080 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-2-methylsulfanylpyrimidin-4-one |
| SMILES | CSc1nc(=O)ccn1[C@H]1C[C@H](N=[N+]=[N-])[C@@H](CO)O1 |
| InChI | InChI=1S/C10H13N5O3S/c1-19-10-12-8(17)2-3-15(10)9-4-6(13-14-11)7(5-16)18-9/h2-3,6-7,9,16H,4-5H2,1H3/t6-,7+,9+/m0/s1 |
| InChIKey | BEFACUGIDJHPGF-LKEWCRSYSA-N |
| XLogP | 0.92 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|