C12H14N6O2 — CID 54503487
[(2S,5S)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-azidooxolan-2-yl]methanol (PubChem CID 54503487) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is [(2S,5S)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-azidooxolan-2-yl]methanol.
| Compound Name | [(2S,5S)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-azidooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 54503487 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [(2S,5S)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-azidooxolan-2-yl]methanol |
| SMILES | [N-]=[N+]=NC1C[C@@H](n2ccc3c(N)ccnc32)O[C@@H]1CO |
| InChI | InChI=1S/C12H14N6O2/c13-8-1-3-15-12-7(8)2-4-18(12)11-5-9(16-17-14)10(6-19)20-11/h1-4,9-11,19H,5-6H2,(H2,13,15)/t9?,10-,11+/m1/s1 |
| InChIKey | YEBTXTOORPXTCG-ZOCYIJKUSA-N |
| XLogP | 1.58 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|