C10H13N5O4 — CID 140535435
1-[(2S,4R,5R)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyridin-2-one (PubChem CID 140535435) has the molecular formula C10H13N5O4 and a molecular weight of 267.25 g/mol. Its IUPAC name is 1-[(2S,4R,5R)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyridin-2-one.
| Compound Name | 1-[(2S,4R,5R)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyridin-2-one |
|---|---|
| PubChem CID | 140535435 |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-[(2S,4R,5R)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyridin-2-one |
| SMILES | [N-]=[N+]=N[C@@H]1C[C@@H](n2ccc(NO)cc2=O)O[C@H]1CO |
| InChI | InChI=1S/C10H13N5O4/c11-14-12-7-4-10(19-8(7)5-16)15-2-1-6(13-18)3-9(15)17/h1-3,7-8,10,13,16,18H,4-5H2/t7-,8+,10+/m1/s1 |
| InChIKey | PFUIZYKXFJMANY-WEDXCCLWSA-N |
| XLogP | 0.61 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|