C27H41N4O9PS — CID 159186888
methyl 1-[2-nitro-5-[[[8-oxo-12-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)dodecanoyl]amino]methyl]phenyl]ethyl hydrogen phosphate (PubChem CID 159186888) has the molecular formula C27H41N4O9PS and a molecular weight of 628.69 g/mol. Its IUPAC name is methyl 1-[2-nitro-5-[[[8-oxo-12-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)dodecanoyl]amino]methyl]phenyl]ethyl hydrogen phosphate.
| Compound Name | methyl 1-[2-nitro-5-[[[8-oxo-12-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)dodecanoyl]amino]methyl]phenyl]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 159186888 |
| Molecular Formula | C27H41N4O9PS |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | methyl 1-[2-nitro-5-[[[8-oxo-12-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)dodecanoyl]amino]methyl]phenyl]ethyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC(C)c1cc(CNC(=O)CCCCCCC(=O)CCCCC2SCC3NC(=O)NC32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H41N4O9PS/c1-18(40-41(37,38)39-2)21-15-19(13-14-23(21)31(35)36)16-28-25(33)12-6-4-3-5-9-20(32)10-7-8-11-24-26-22(17-42-24)29-27(34)30-26/h13-15,18,22,24,26H,3-12,16-17H2,1-2H3,(H,28,33)(H,37,38)(H2,29,30,34) |
| InChIKey | MVXNPACIJWXHPY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 186.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|