C12H21N2O5PS — CID 118722124
[6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-oxohexyl]-methoxyphosphinic acid (PubChem CID 118722124) has the molecular formula C12H21N2O5PS and a molecular weight of 336.35 g/mol. Its IUPAC name is [6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-oxohexyl]-methoxyphosphinic acid.
| Compound Name | [6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-oxohexyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 118722124 |
| Molecular Formula | C12H21N2O5PS |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-oxohexyl]-methoxyphosphinic acid |
| SMILES | COP(=O)(O)CC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C12H21N2O5PS/c1-19-20(17,18)6-8(15)4-2-3-5-10-11-9(7-21-10)13-12(16)14-11/h9-11H,2-7H2,1H3,(H,17,18)(H2,13,14,16)/t9-,10-,11-/m0/s1 |
| InChIKey | CUBQSJANTCEOHH-DCAQKATOSA-N |
| XLogP | 1.11 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|