C12H20N2O2S3 — CID 126735575
4-[6-(methyldisulfanyl)-5-oxohexyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 126735575) has the molecular formula C12H20N2O2S3 and a molecular weight of 320.51 g/mol. Its IUPAC name is 4-[6-(methyldisulfanyl)-5-oxohexyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | 4-[6-(methyldisulfanyl)-5-oxohexyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 126735575 |
| Molecular Formula | C12H20N2O2S3 |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 4-[6-(methyldisulfanyl)-5-oxohexyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | CSSCC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C12H20N2O2S3/c1-17-19-6-8(15)4-2-3-5-10-11-9(7-18-10)13-12(16)14-11/h9-11H,2-7H2,1H3,(H2,13,14,16) |
| InChIKey | IDNGVGRLZZPLHX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|