C21H35N2O7P — CID 135196641
1-[5-[(4-ethylheptanoylamino)methyl]-2-nitrophenyl]ethyl propan-2-yl hydrogen phosphate (PubChem CID 135196641) has the molecular formula C21H35N2O7P and a molecular weight of 458.49 g/mol. Its IUPAC name is 1-[5-[(4-ethylheptanoylamino)methyl]-2-nitrophenyl]ethyl propan-2-yl hydrogen phosphate.
| Compound Name | 1-[5-[(4-ethylheptanoylamino)methyl]-2-nitrophenyl]ethyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 135196641 |
| Molecular Formula | C21H35N2O7P |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 1-[5-[(4-ethylheptanoylamino)methyl]-2-nitrophenyl]ethyl propan-2-yl hydrogen phosphate |
| SMILES | CCCC(CC)CCC(=O)NCc1ccc([N+](=O)[O-])c(C(C)OP(=O)(O)OC(C)C)c1 |
| InChI | InChI=1S/C21H35N2O7P/c1-6-8-17(7-2)10-12-21(24)22-14-18-9-11-20(23(25)26)19(13-18)16(5)30-31(27,28)29-15(3)4/h9,11,13,15-17H,6-8,10,12,14H2,1-5H3,(H,22,24)(H,27,28) |
| InChIKey | NVPIVYOKCQOMKP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|