C21H37NO3 — CID 163654832
methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide (PubChem CID 163654832) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide.
| Compound Name | methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide |
|---|---|
| PubChem CID | 163654832 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide |
| SMILES | C.Cc1ccc(CNC(=O)CCCOC(C)C)cc1C(C)OC(C)C |
| InChI | InChI=1S/C20H33NO3.CH4/c1-14(2)23-11-7-8-20(22)21-13-18-10-9-16(5)19(12-18)17(6)24-15(3)4;/h9-10,12,14-15,17H,7-8,11,13H2,1-6H3,(H,21,22);1H4 |
| InChIKey | IPHRJXODCTWCKJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|