About methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide
methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide (PubChem CID 163654832) has the molecular formula C21H37NO3
and a molecular weight of 351.53 g/mol. Its IUPAC name is methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide.
Molecular Properties
| Compound Name | methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide |
| PubChem CID | 163654832 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide |
| SMILES | C.Cc1ccc(CNC(=O)CCCOC(C)C)cc1C(C)OC(C)C |
| InChI | InChI=1S/C20H33NO3.CH4/c1-14(2)23-11-7-8-20(22)21-13-18-10-9-16(5)19(12-18)17(6)24-15(3)4;/h9-10,12,14-15,17H,7-8,11,13H2,1-6H3,(H,21,22);1H4 |
| InChIKey | IPHRJXODCTWCKJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide?
The IUPAC name of methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide (CID 163654832) is methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide.
What is the SMILES notation for methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide?
The canonical SMILES for methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide is C.Cc1ccc(CNC(=O)CCCOC(C)C)cc1C(C)OC(C)C.
What is the InChIKey of methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide?
The InChIKey is IPHRJXODCTWCKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33NO3.CH4/c1-14(2)23-11-7-8-20(22)21-13-18-10-9-16(5)19(12-18)17(6)24-15(3)4;/h9-10,12,14-15,17H,7-8,11,13H2,1-6H3,(H,21,22);1H4.
What are the key properties of methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide?
methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide has a molecular weight of 351.53 g/mol, XLogP of 4.94, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-[[4-methyl-3-(1-propan-2-yloxyethyl)phenyl]methyl]-4-propan-2-yloxybutanamide is sourced from PubChem (CID 163654832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).