C17H25NO4 — CID 153300154
1-[5-(2,2-dimethylpropyl)-2-nitrophenyl]ethyl 2-methylpropanoate (PubChem CID 153300154) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-[5-(2,2-dimethylpropyl)-2-nitrophenyl]ethyl 2-methylpropanoate.
| Compound Name | 1-[5-(2,2-dimethylpropyl)-2-nitrophenyl]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 153300154 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-[5-(2,2-dimethylpropyl)-2-nitrophenyl]ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(C)c1cc(CC(C)(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25NO4/c1-11(2)16(19)22-12(3)14-9-13(10-17(4,5)6)7-8-15(14)18(20)21/h7-9,11-12H,10H2,1-6H3 |
| InChIKey | NJGYPUKOQYHQRA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|