C15H21N3O6 — CID 175332147
2,6-diamino-7-[1-(2-nitrophenyl)ethoxy]-7-oxoheptanoic acid (PubChem CID 175332147) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2,6-diamino-7-[1-(2-nitrophenyl)ethoxy]-7-oxoheptanoic acid.
| Compound Name | 2,6-diamino-7-[1-(2-nitrophenyl)ethoxy]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 175332147 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2,6-diamino-7-[1-(2-nitrophenyl)ethoxy]-7-oxoheptanoic acid |
| SMILES | CC(OC(=O)C(N)CCCC(N)C(=O)O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O6/c1-9(10-5-2-3-8-13(10)18(22)23)24-15(21)12(17)7-4-6-11(16)14(19)20/h2-3,5,8-9,11-12H,4,6-7,16-17H2,1H3,(H,19,20) |
| InChIKey | JNBRXOZXCKUOHA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 158.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|