C19H30N2O4 — CID 67761867
1-(2-nitrophenyl)ethyl 11-aminoundecanoate (PubChem CID 67761867) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-(2-nitrophenyl)ethyl 11-aminoundecanoate.
| Compound Name | 1-(2-nitrophenyl)ethyl 11-aminoundecanoate |
|---|---|
| PubChem CID | 67761867 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 1-(2-nitrophenyl)ethyl 11-aminoundecanoate |
| SMILES | CC(OC(=O)CCCCCCCCCCN)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H30N2O4/c1-16(17-12-9-10-13-18(17)21(23)24)25-19(22)14-8-6-4-2-3-5-7-11-15-20/h9-10,12-13,16H,2-8,11,14-15,20H2,1H3 |
| InChIKey | BYXFEPMTMSRHKO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|