C18H16N4O5 — CID 60611582
1-(2-nitrophenyl)ethyl 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate (PubChem CID 60611582) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is 1-(2-nitrophenyl)ethyl 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate.
| Compound Name | 1-(2-nitrophenyl)ethyl 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate |
|---|---|
| PubChem CID | 60611582 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-(2-nitrophenyl)ethyl 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate |
| SMILES | CC(OC(=O)CCn1nnc2ccccc2c1=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N4O5/c1-12(13-6-3-5-9-16(13)22(25)26)27-17(23)10-11-21-18(24)14-7-2-4-8-15(14)19-20-21/h2-9,12H,10-11H2,1H3 |
| InChIKey | LOLVOWXIULIOLT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 117.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|