C20H14ClN3O3 — CID 34804036
(4-chloronaphthalen-1-yl) 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate (PubChem CID 34804036) has the molecular formula C20H14ClN3O3 and a molecular weight of 379.80 g/mol. Its IUPAC name is (4-chloronaphthalen-1-yl) 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate.
| Compound Name | (4-chloronaphthalen-1-yl) 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate |
|---|---|
| PubChem CID | 34804036 |
| Molecular Formula | C20H14ClN3O3 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (4-chloronaphthalen-1-yl) 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate |
| SMILES | O=C(CCn1nnc2ccccc2c1=O)Oc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C20H14ClN3O3/c21-16-9-10-18(14-6-2-1-5-13(14)16)27-19(25)11-12-24-20(26)15-7-3-4-8-17(15)22-23-24/h1-10H,11-12H2 |
| InChIKey | SZQOUDCFXXKBIL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|