C16H12ClN3O3 — CID 34802734
(2-chlorophenyl) 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate (PubChem CID 34802734) has the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. Its IUPAC name is (2-chlorophenyl) 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate.
| Compound Name | (2-chlorophenyl) 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate |
|---|---|
| PubChem CID | 34802734 |
| Molecular Formula | C16H12ClN3O3 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (2-chlorophenyl) 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoate |
| SMILES | O=C(CCn1nnc2ccccc2c1=O)Oc1ccccc1Cl |
| InChI | InChI=1S/C16H12ClN3O3/c17-12-6-2-4-8-14(12)23-15(21)9-10-20-16(22)11-5-1-3-7-13(11)18-19-20/h1-8H,9-10H2 |
| InChIKey | KYPCLJGIZLOCNG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|