C14H9Cl2N3O2 — CID 2087484
3-[(2,3-dichlorophenoxy)methyl]-1,2,3-benzotriazin-4-one (PubChem CID 2087484) has the molecular formula C14H9Cl2N3O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenoxy)methyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(2,3-dichlorophenoxy)methyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 2087484 |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 3-[(2,3-dichlorophenoxy)methyl]-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2ccccc2nnn1COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H9Cl2N3O2/c15-10-5-3-7-12(13(10)16)21-8-19-14(20)9-4-1-2-6-11(9)17-18-19/h1-7H,8H2 |
| InChIKey | SGJFWVVMADRWME-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |