C16H12ClN3O4 — CID 7804023
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-(3-chlorophenoxy)acetate (PubChem CID 7804023) has the molecular formula C16H12ClN3O4 and a molecular weight of 345.74 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-(3-chlorophenoxy)acetate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 7804023 |
| Molecular Formula | C16H12ClN3O4 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-(3-chlorophenoxy)acetate |
| SMILES | O=C(COc1cccc(Cl)c1)OCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C16H12ClN3O4/c17-11-4-3-5-12(8-11)23-9-15(21)24-10-20-16(22)13-6-1-2-7-14(13)18-19-20/h1-8H,9-10H2 |
| InChIKey | LRXYRLMJZQEFCH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |