C18H17N3O4 — CID 2548793
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-phenoxybutanoate (PubChem CID 2548793) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-phenoxybutanoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-phenoxybutanoate |
|---|---|
| PubChem CID | 2548793 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-phenoxybutanoate |
| SMILES | O=C(CCCOc1ccccc1)OCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C18H17N3O4/c22-17(11-6-12-24-14-7-2-1-3-8-14)25-13-21-18(23)15-9-4-5-10-16(15)19-20-21/h1-5,7-10H,6,11-13H2 |
| InChIKey | HLKIFWWZUKKGQA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|