C14H18N4O3 — CID 60671817
ethyl 4-[(4-oxo-1,2,3-benzotriazin-3-yl)methylamino]butanoate (PubChem CID 60671817) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 4-[(4-oxo-1,2,3-benzotriazin-3-yl)methylamino]butanoate.
| Compound Name | ethyl 4-[(4-oxo-1,2,3-benzotriazin-3-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 60671817 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | ethyl 4-[(4-oxo-1,2,3-benzotriazin-3-yl)methylamino]butanoate |
| SMILES | CCOC(=O)CCCNCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C14H18N4O3/c1-2-21-13(19)8-5-9-15-10-18-14(20)11-6-3-4-7-12(11)16-17-18/h3-4,6-7,15H,2,5,8-10H2,1H3 |
| InChIKey | KDSIFBIPRSYZEM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|