C14H20ClN5O2 — CID 119505285
N-[2-(ethylamino)ethyl]-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide;hydrochloride (PubChem CID 119505285) has the molecular formula C14H20ClN5O2 and a molecular weight of 325.80 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119505285 |
| Molecular Formula | C14H20ClN5O2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide;hydrochloride |
| SMILES | CCNCCNC(=O)CCn1nnc2ccccc2c1=O.Cl |
| InChI | InChI=1S/C14H19N5O2.ClH/c1-2-15-8-9-16-13(20)7-10-19-14(21)11-5-3-4-6-12(11)17-18-19;/h3-6,15H,2,7-10H2,1H3,(H,16,20);1H |
| InChIKey | WCJGUWZQZORVDF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|