C18H18N4O2S — CID 39444643
3-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(2-phenylsulfanylethyl)propanamide (PubChem CID 39444643) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 3-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(2-phenylsulfanylethyl)propanamide.
| Compound Name | 3-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(2-phenylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 39444643 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(2-phenylsulfanylethyl)propanamide |
| SMILES | O=C(CCn1nnc2ccccc2c1=O)NCCSc1ccccc1 |
| InChI | InChI=1S/C18H18N4O2S/c23-17(19-11-13-25-14-6-2-1-3-7-14)10-12-22-18(24)15-8-4-5-9-16(15)20-21-22/h1-9H,10-13H2,(H,19,23) |
| InChIKey | ISZPFXDVWNDPGU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|