C14H9ClN4O3 — CID 2636773
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 6-chloropyridine-3-carboxylate (PubChem CID 2636773) has the molecular formula C14H9ClN4O3 and a molecular weight of 316.70 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 6-chloropyridine-3-carboxylate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2636773 |
| Molecular Formula | C14H9ClN4O3 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 6-chloropyridine-3-carboxylate |
| SMILES | O=C(OCn1nnc2ccccc2c1=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H9ClN4O3/c15-12-6-5-9(7-16-12)14(21)22-8-19-13(20)10-3-1-2-4-11(10)17-18-19/h1-7H,8H2 |
| InChIKey | AECCDRSLNUNCDI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|