C20H18N4O4 — CID 9475876
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(2-oxopiperidin-1-yl)benzoate (PubChem CID 9475876) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(2-oxopiperidin-1-yl)benzoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(2-oxopiperidin-1-yl)benzoate |
|---|---|
| PubChem CID | 9475876 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(2-oxopiperidin-1-yl)benzoate |
| SMILES | O=C(OCn1nnc2ccccc2c1=O)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C20H18N4O4/c25-18-7-3-4-12-23(18)15-10-8-14(9-11-15)20(27)28-13-24-19(26)16-5-1-2-6-17(16)21-22-24/h1-2,5-6,8-11H,3-4,7,12-13H2 |
| InChIKey | BKIHKHWFFGUCDS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |