C19H14N4O5 — CID 7204399
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 7204399) has the molecular formula C19H14N4O5 and a molecular weight of 378.34 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7204399 |
| Molecular Formula | C19H14N4O5 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCn1nnc2ccccc2c1=O)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C19H14N4O5/c24-16-9-10-17(25)23(16)13-7-5-12(6-8-13)19(27)28-11-22-18(26)14-3-1-2-4-15(14)20-21-22/h1-8H,9-11H2 |
| InChIKey | QXCJVBIVACCJET-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|