C19H17N3O3S2 — CID 8595090
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(1,3-dithian-2-yl)benzoate (PubChem CID 8595090) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(1,3-dithian-2-yl)benzoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(1,3-dithian-2-yl)benzoate |
|---|---|
| PubChem CID | 8595090 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(1,3-dithian-2-yl)benzoate |
| SMILES | O=C(OCn1nnc2ccccc2c1=O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C19H17N3O3S2/c23-17-15-4-1-2-5-16(15)20-21-22(17)12-25-18(24)13-6-8-14(9-7-13)19-26-10-3-11-27-19/h1-2,4-9,19H,3,10-12H2 |
| InChIKey | OUHBVYBLBJMKFG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |