C18H17N3O4 — CID 866910
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-propan-2-yloxybenzoate (PubChem CID 866910) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-propan-2-yloxybenzoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 866910 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1ccc(C(=O)OCn2nnc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C18H17N3O4/c1-12(2)25-14-9-7-13(8-10-14)18(23)24-11-21-17(22)15-5-3-4-6-16(15)19-20-21/h3-10,12H,11H2,1-2H3 |
| InChIKey | LEUDMZHTWNSXPW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |