C14H8Cl3N5O3 — CID 16571227
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 16571227) has the molecular formula C14H8Cl3N5O3 and a molecular weight of 400.61 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 16571227 |
| Molecular Formula | C14H8Cl3N5O3 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)OCn2nnc3ccccc3c2=O)c1Cl |
| InChI | InChI=1S/C14H8Cl3N5O3/c15-8-10(18)9(16)12(17)19-11(8)14(24)25-5-22-13(23)6-3-1-2-4-7(6)20-21-22/h1-4H,5H2,(H2,18,19) |
| InChIKey | DBSDKXQXAFMWMX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|